C10H10N2O4 — CID 102422386
(3aS,4aR,7aS,8aR)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 102422386) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is (3aS,4aR,7aS,8aR)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | (3aS,4aR,7aS,8aR)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 102422386 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (3aS,4aR,7aS,8aR)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=C1NC(=O)[C@@H]2C[C@@H]3C(=O)NC(=O)[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C10H10N2O4/c13-7-3-1-4-6(10(16)12-8(4)14)2-5(3)9(15)11-7/h3-6H,1-2H2,(H,11,13,15)(H,12,14,16)/t3-,4+,5+,6- |
| InChIKey | ISRZBILIFOXJFK-GUCUJZIJSA-N |
| XLogP | -1.44 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|