C13H13N3 — CID 10242255
5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]pyridine-3-carbonitrile (PubChem CID 10242255) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10242255 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-[(3aR,6aS)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(C2=C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C13H13N3/c14-4-9-1-11(6-15-5-9)10-2-12-7-16-8-13(12)3-10/h1-2,5-6,12-13,16H,3,7-8H2/t12-,13+/m0/s1 |
| InChIKey | HXFPKTYITQFKLH-QWHCGFSZSA-N |
| XLogP | 1.58 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |