About 3-thiophen-3-ylquinoline
3-thiophen-3-ylquinoline (PubChem CID 10242258) has the molecular formula C13H9NS
and a molecular weight of 211.29 g/mol. Its IUPAC name is 3-thiophen-3-ylquinoline.
Molecular Properties
| Compound Name | 3-thiophen-3-ylquinoline |
| PubChem CID | 10242258 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3-thiophen-3-ylquinoline |
| SMILES | c1ccc2ncc(-c3ccsc3)cc2c1 |
| InChI | InChI=1S/C13H9NS/c1-2-4-13-10(3-1)7-12(8-14-13)11-5-6-15-9-11/h1-9H |
| InChIKey | ZWOOWBWBVMAYGL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-thiophen-3-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-ylquinoline?
The IUPAC name of 3-thiophen-3-ylquinoline (CID 10242258) is 3-thiophen-3-ylquinoline.
What is the SMILES notation for 3-thiophen-3-ylquinoline?
The canonical SMILES for 3-thiophen-3-ylquinoline is c1ccc2ncc(-c3ccsc3)cc2c1.
What is the InChIKey of 3-thiophen-3-ylquinoline?
The InChIKey is ZWOOWBWBVMAYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS/c1-2-4-13-10(3-1)7-12(8-14-13)11-5-6-15-9-11/h1-9H.
What are the key properties of 3-thiophen-3-ylquinoline?
3-thiophen-3-ylquinoline has a molecular weight of 211.29 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-ylquinoline is sourced from PubChem (CID 10242258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).