C11H17NO — CID 102423827
(1S,3R,3aS,7aR)-3,3a-dimethyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carbonitrile (PubChem CID 102423827) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (1S,3R,3aS,7aR)-3,3a-dimethyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carbonitrile.
| Compound Name | (1S,3R,3aS,7aR)-3,3a-dimethyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 102423827 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (1S,3R,3aS,7aR)-3,3a-dimethyl-3,4,5,6,7,7a-hexahydro-1H-2-benzofuran-1-carbonitrile |
| SMILES | C[C@H]1O[C@H](C#N)[C@@H]2CCCC[C@]12C |
| InChI | InChI=1S/C11H17NO/c1-8-11(2)6-4-3-5-9(11)10(7-12)13-8/h8-10H,3-6H2,1-2H3/t8-,9+,10-,11-/m1/s1 |
| InChIKey | UJACRNYOSIAPOY-LMLFDSFASA-N |
| XLogP | 2.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |