C18H15ClO7 — CID 102424098
diethyl 8-chloro-10-oxo-4aH-pyrano[4,3-b]chromene-3,4-dicarboxylate (PubChem CID 102424098) has the molecular formula C18H15ClO7 and a molecular weight of 378.76 g/mol. Its IUPAC name is diethyl 8-chloro-10-oxo-4aH-pyrano[4,3-b]chromene-3,4-dicarboxylate.
| Compound Name | diethyl 8-chloro-10-oxo-4aH-pyrano[4,3-b]chromene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102424098 |
| Molecular Formula | C18H15ClO7 |
| Molecular Weight | 378.76 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | diethyl 8-chloro-10-oxo-4aH-pyrano[4,3-b]chromene-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2Oc3ccc(Cl)cc3C(=O)C2=CO1 |
| InChI | InChI=1S/C18H15ClO7/c1-3-23-17(21)13-15-11(8-25-16(13)18(22)24-4-2)14(20)10-7-9(19)5-6-12(10)26-15/h5-8,15H,3-4H2,1-2H3 |
| InChIKey | BWLWBGSVVNEHDK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.76 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |