C21H10N8 — CID 102424312
3-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]penta-1,4-diene-1,1,2,5,5-pentacarbonitrile (PubChem CID 102424312) has the molecular formula C21H10N8 and a molecular weight of 374.37 g/mol. Its IUPAC name is 3-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]penta-1,4-diene-1,1,2,5,5-pentacarbonitrile.
| Compound Name | 3-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]penta-1,4-diene-1,1,2,5,5-pentacarbonitrile |
|---|---|
| PubChem CID | 102424312 |
| Molecular Formula | C21H10N8 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]penta-1,4-diene-1,1,2,5,5-pentacarbonitrile |
| SMILES | CN(C)c1ccc(C(=C(C#N)C#N)C(=C(C#N)C#N)C(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C21H10N8/c1-29(2)18-5-3-14(4-6-18)20(16(9-24)10-25)21(17(11-26)12-27)19(13-28)15(7-22)8-23/h3-6H,1-2H3 |
| InChIKey | POBRFPNOPLHBGI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 169.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|