About (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol
(6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol (PubChem CID 10242437) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol |
| PubChem CID | 10242437 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CCC/C(=C\c2ccccc2)C1O |
| InChI | InChI=1S/C15H20O/c1-15(2)10-6-9-13(14(15)16)11-12-7-4-3-5-8-12/h3-5,7-8,11,14,16H,6,9-10H2,1-2H3/b13-11+ |
| InChIKey | QHUVFBYRKOUMBW-ACCUITESSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol?
The IUPAC name of (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol (CID 10242437) is (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol.
What is the SMILES notation for (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol?
The canonical SMILES for (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol is CC1(C)CCC/C(=C\c2ccccc2)C1O.
What is the InChIKey of (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol?
The InChIKey is QHUVFBYRKOUMBW-ACCUITESSA-N. The full InChI is InChI=1S/C15H20O/c1-15(2)10-6-9-13(14(15)16)11-12-7-4-3-5-8-12/h3-5,7-8,11,14,16H,6,9-10H2,1-2H3/b13-11+.
What are the key properties of (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol?
(6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol has a molecular weight of 216.32 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-benzylidene-2,2-dimethylcyclohexan-1-ol is sourced from PubChem (CID 10242437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).