C10H15NO — CID 102424511
(2Z,5S,6E)-5-hydroxy-5,6-dimethylocta-2,6-dienenitrile (PubChem CID 102424511) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2Z,5S,6E)-5-hydroxy-5,6-dimethylocta-2,6-dienenitrile.
| Compound Name | (2Z,5S,6E)-5-hydroxy-5,6-dimethylocta-2,6-dienenitrile |
|---|---|
| PubChem CID | 102424511 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2Z,5S,6E)-5-hydroxy-5,6-dimethylocta-2,6-dienenitrile |
| SMILES | C/C=C(\C)[C@@](C)(O)C/C=C\C#N |
| InChI | InChI=1S/C10H15NO/c1-4-9(2)10(3,12)7-5-6-8-11/h4-6,12H,7H2,1-3H3/b6-5-,9-4+/t10-/m0/s1 |
| InChIKey | USWWRIZYARODAD-QALSAPHGSA-N |
| XLogP | 2.17 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|