C17H19F3O4 — CID 102424576
2-[(1S,2R)-2-hydroxycyclopent-3-en-1-yl]ethyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 102424576) has the molecular formula C17H19F3O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2-[(1S,2R)-2-hydroxycyclopent-3-en-1-yl]ethyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | 2-[(1S,2R)-2-hydroxycyclopent-3-en-1-yl]ethyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 102424576 |
| Molecular Formula | C17H19F3O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[(1S,2R)-2-hydroxycyclopent-3-en-1-yl]ethyl (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)OCC[C@@H]1CC=C[C@@H]1O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3O4/c1-23-16(17(18,19)20,13-7-3-2-4-8-13)15(22)24-11-10-12-6-5-9-14(12)21/h2-5,7-9,12,14,21H,6,10-11H2,1H3/t12-,14-,16-/m0/s1 |
| InChIKey | IJLCSZUQLOUOMV-NOLJZWGESA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|