C24H39AsO — CID 102425049
(3Z,6Z,9Z,12Z,15Z,18Z)-1-dimethylarsoryldocosa-3,6,9,12,15,18-hexaene (PubChem CID 102425049) has the molecular formula C24H39AsO and a molecular weight of 418.50 g/mol. Its IUPAC name is (3Z,6Z,9Z,12Z,15Z,18Z)-1-dimethylarsoryldocosa-3,6,9,12,15,18-hexaene.
| Compound Name | (3Z,6Z,9Z,12Z,15Z,18Z)-1-dimethylarsoryldocosa-3,6,9,12,15,18-hexaene |
|---|---|
| PubChem CID | 102425049 |
| Molecular Formula | C24H39AsO |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (3Z,6Z,9Z,12Z,15Z,18Z)-1-dimethylarsoryldocosa-3,6,9,12,15,18-hexaene |
| SMILES | CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC[As](C)(C)=O |
| InChI | InChI=1S/C24H39AsO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(2,3)26/h6-7,9-10,12-13,15-16,18-19,21-22H,4-5,8,11,14,17,20,23-24H2,1-3H3/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21- |
| InChIKey | HMJBSBOBGPIMOY-WSDBEMKQSA-N |
| XLogP | 8.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|