C16H20N2OS — CID 102425655
(2R,3S)-N-butyl-4-cyano-3-phenyl-2-sulfanylpent-4-enamide (PubChem CID 102425655) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is (2R,3S)-N-butyl-4-cyano-3-phenyl-2-sulfanylpent-4-enamide.
| Compound Name | (2R,3S)-N-butyl-4-cyano-3-phenyl-2-sulfanylpent-4-enamide |
|---|---|
| PubChem CID | 102425655 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2R,3S)-N-butyl-4-cyano-3-phenyl-2-sulfanylpent-4-enamide |
| SMILES | C=C(C#N)[C@H](c1ccccc1)[C@@H](S)C(=O)NCCCC |
| InChI | InChI=1S/C16H20N2OS/c1-3-4-10-18-16(19)15(20)14(12(2)11-17)13-8-6-5-7-9-13/h5-9,14-15,20H,2-4,10H2,1H3,(H,18,19)/t14-,15-/m1/s1 |
| InChIKey | KUDCNGVOWVILBR-HUUCEWRRSA-N |
| XLogP | 3.06 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|