About [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate
[(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate (PubChem CID 102426593) has the molecular formula C15H20O2S
and a molecular weight of 264.39 g/mol. Its IUPAC name is [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate |
| PubChem CID | 102426593 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)O[C@]2(C)CCC3CC2C3)cc1 |
| InChI | InChI=1S/C15H20O2S/c1-11-3-5-14(6-4-11)18(16)17-15(2)8-7-12-9-13(15)10-12/h3-6,12-13H,7-10H2,1-2H3/t12?,13?,15-,18?/m1/s1 |
| InChIKey | KARGETSSGPZJPZ-RPTXSPESSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate?
The IUPAC name of [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate (CID 102426593) is [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate.
What is the SMILES notation for [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate?
The canonical SMILES for [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate is Cc1ccc(S(=O)O[C@]2(C)CCC3CC2C3)cc1.
What is the InChIKey of [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate?
The InChIKey is KARGETSSGPZJPZ-RPTXSPESSA-N. The full InChI is InChI=1S/C15H20O2S/c1-11-3-5-14(6-4-11)18(16)17-15(2)8-7-12-9-13(15)10-12/h3-6,12-13H,7-10H2,1-2H3/t12?,13?,15-,18?/m1/s1.
What are the key properties of [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate?
[(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate has a molecular weight of 264.39 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-methyl-2-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfinate is sourced from PubChem (CID 102426593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).