About (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal
(E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal (PubChem CID 102426663) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal.
Molecular Properties
| Compound Name | (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal |
| PubChem CID | 102426663 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal |
| SMILES | CCCC[C@@](/C=C/C=O)(CC)C1OCCO1 |
| InChI | InChI=1S/C13H22O3/c1-3-5-7-13(4-2,8-6-9-14)12-15-10-11-16-12/h6,8-9,12H,3-5,7,10-11H2,1-2H3/b8-6+/t13-/m1/s1 |
| InChIKey | UWPWLCWLAMARAD-STMXVASLSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal?
The IUPAC name of (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal (CID 102426663) is (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal.
What is the SMILES notation for (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal?
The canonical SMILES for (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal is CCCC[C@@](/C=C/C=O)(CC)C1OCCO1.
What is the InChIKey of (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal?
The InChIKey is UWPWLCWLAMARAD-STMXVASLSA-N. The full InChI is InChI=1S/C13H22O3/c1-3-5-7-13(4-2,8-6-9-14)12-15-10-11-16-12/h6,8-9,12H,3-5,7,10-11H2,1-2H3/b8-6+/t13-/m1/s1.
What are the key properties of (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal?
(E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal has a molecular weight of 226.32 g/mol, XLogP of 2.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4R)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal is sourced from PubChem (CID 102426663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).