C21H32O2 — CID 102427198
3-[(8Z,11Z)-hexadeca-8,11-dienyl]-5-methylidenefuran-2-one (PubChem CID 102427198) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 3-[(8Z,11Z)-hexadeca-8,11-dienyl]-5-methylidenefuran-2-one.
| Compound Name | 3-[(8Z,11Z)-hexadeca-8,11-dienyl]-5-methylidenefuran-2-one |
|---|---|
| PubChem CID | 102427198 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 3-[(8Z,11Z)-hexadeca-8,11-dienyl]-5-methylidenefuran-2-one |
| SMILES | C=C1C=C(CCCCCCC/C=C\C/C=C\CCCC)C(=O)O1 |
| InChI | InChI=1S/C21H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18-19(2)23-21(20)22/h6-7,9-10,18H,2-5,8,11-17H2,1H3/b7-6-,10-9- |
| InChIKey | OFIYDTXDCYKLAH-HZJYTTRNSA-N |
| XLogP | 6.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|