C17H28O5 — CID 102427474
(2S,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpentane-1,2,3-triol (PubChem CID 102427474) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpentane-1,2,3-triol.
| Compound Name | (2S,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpentane-1,2,3-triol |
|---|---|
| PubChem CID | 102427474 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2S,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methylpentane-1,2,3-triol |
| SMILES | COc1c(C)c(C)c(OC)c(CC[C@](C)(O)[C@@H](O)CO)c1C |
| InChI | InChI=1S/C17H28O5/c1-10-11(2)16(22-6)13(12(3)15(10)21-5)7-8-17(4,20)14(19)9-18/h14,18-20H,7-9H2,1-6H3/t14-,17-/m0/s1 |
| InChIKey | XRIDNNIEROQNHQ-YOEHRIQHSA-N |
| XLogP | 1.67 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |