C14H10F8OS — CID 102427548
2-[(Z)-2,3,3,4,4,5,5,5-octafluoropent-1-enyl]-2-phenyl-1,3-oxathiolane (PubChem CID 102427548) has the molecular formula C14H10F8OS and a molecular weight of 378.28 g/mol. Its IUPAC name is 2-[(Z)-2,3,3,4,4,5,5,5-octafluoropent-1-enyl]-2-phenyl-1,3-oxathiolane.
| Compound Name | 2-[(Z)-2,3,3,4,4,5,5,5-octafluoropent-1-enyl]-2-phenyl-1,3-oxathiolane |
|---|---|
| PubChem CID | 102427548 |
| Molecular Formula | C14H10F8OS |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2-[(Z)-2,3,3,4,4,5,5,5-octafluoropent-1-enyl]-2-phenyl-1,3-oxathiolane |
| SMILES | F/C(=C\C1(c2ccccc2)OCCS1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F8OS/c15-10(12(16,17)13(18,19)14(20,21)22)8-11(23-6-7-24-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2/b10-8- |
| InChIKey | PLOSJPPTVOLRAB-NTMALXAHSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|