About 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol
2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol (PubChem CID 10242773) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 10242773 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CC(Cc1ccncc1)C2 |
| InChI | InChI=1S/C15H15NO/c17-15-3-1-2-13-9-12(10-14(13)15)8-11-4-6-16-7-5-11/h1-7,12,17H,8-10H2 |
| InChIKey | HMFZHKWCZQZHQP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol (CID 10242773) is 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol is Oc1cccc2c1CC(Cc1ccncc1)C2.
What is the InChIKey of 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol?
The InChIKey is HMFZHKWCZQZHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c17-15-3-1-2-13-9-12(10-14(13)15)8-11-4-6-16-7-5-11/h1-7,12,17H,8-10H2.
What are the key properties of 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol?
2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol has a molecular weight of 225.29 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 10242773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).