C18H34O4Si — CID 102427745
methyl (2R,5S)-5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-hydroxy-6-methyl-4-methylidenehept-6-enoate (PubChem CID 102427745) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is methyl (2R,5S)-5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-hydroxy-6-methyl-4-methylidenehept-6-enoate.
| Compound Name | methyl (2R,5S)-5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-hydroxy-6-methyl-4-methylidenehept-6-enoate |
|---|---|
| PubChem CID | 102427745 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | methyl (2R,5S)-5-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-hydroxy-6-methyl-4-methylidenehept-6-enoate |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C(C)C)C(=C)C[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C18H34O4Si/c1-12(2)16(14(5)11-15(19)17(20)21-8)22-23(9,10)18(6,7)13(3)4/h13,15-16,19H,1,5,11H2,2-4,6-10H3/t15-,16+/m1/s1 |
| InChIKey | FRSJIZRPSINYOL-CVEARBPZSA-N |
| XLogP | 4.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|