C33H46O5Si — CID 102427761
1-[(1R,3R,4R,5S,6R,7R,8R,9R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[6.2.1.04,9]undecan-3-yl]ethanone (PubChem CID 102427761) has the molecular formula C33H46O5Si and a molecular weight of 550.81 g/mol. Its IUPAC name is 1-[(1R,3R,4R,5S,6R,7R,8R,9R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[6.2.1.04,9]undecan-3-yl]ethanone.
| Compound Name | 1-[(1R,3R,4R,5S,6R,7R,8R,9R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[6.2.1.04,9]undecan-3-yl]ethanone |
|---|---|
| PubChem CID | 102427761 |
| Molecular Formula | C33H46O5Si |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 1-[(1R,3R,4R,5S,6R,7R,8R,9R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[6.2.1.04,9]undecan-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@]2(O[Si](C)(C)C(C)(C)C)C[C@H]3[C@@H](O2)[C@H](OCc2ccccc2)[C@H](C)[C@@H](OCc2ccccc2)[C@H]31 |
| InChI | InChI=1S/C33H46O5Si/c1-22-29(35-20-24-14-10-8-11-15-24)28-26(23(2)34)18-33(38-39(6,7)32(3,4)5)19-27(28)31(37-33)30(22)36-21-25-16-12-9-13-17-25/h8-17,22,26-31H,18-21H2,1-7H3/t22-,26+,27-,28+,29-,30-,31-,33+/m1/s1 |
| InChIKey | VAUWCFOUZVSRRZ-ZNAUEMKNSA-N |
| XLogP | 7.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|