C17H18O7 — CID 102427811
2-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]naphthalene-1,4-dione (PubChem CID 102427811) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]naphthalene-1,4-dione.
| Compound Name | 2-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 102427811 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]naphthalene-1,4-dione |
| SMILES | O=C1C=C(C[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H18O7/c18-7-13-16(22)17(23)15(21)12(24-13)6-8-5-11(19)9-3-1-2-4-10(9)14(8)20/h1-5,12-13,15-18,21-23H,6-7H2/t12-,13-,15+,16-,17-/m1/s1 |
| InChIKey | NTYPINVOWDKYGP-MAURAIGZSA-N |
| XLogP | -0.78 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|