About 2-(phenylmethoxymethyl)-1,3-dithiolane
2-(phenylmethoxymethyl)-1,3-dithiolane (PubChem CID 10242821) has the molecular formula C11H14OS2
and a molecular weight of 226.37 g/mol. Its IUPAC name is 2-(phenylmethoxymethyl)-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-(phenylmethoxymethyl)-1,3-dithiolane |
| PubChem CID | 10242821 |
| Molecular Formula | C11H14OS2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(phenylmethoxymethyl)-1,3-dithiolane |
| SMILES | c1ccc(COCC2SCCS2)cc1 |
| InChI | InChI=1S/C11H14OS2/c1-2-4-10(5-3-1)8-12-9-11-13-6-7-14-11/h1-5,11H,6-9H2 |
| InChIKey | PNLLMBZPRSWHPK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(phenylmethoxymethyl)-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenylmethoxymethyl)-1,3-dithiolane?
The IUPAC name of 2-(phenylmethoxymethyl)-1,3-dithiolane (CID 10242821) is 2-(phenylmethoxymethyl)-1,3-dithiolane.
What is the SMILES notation for 2-(phenylmethoxymethyl)-1,3-dithiolane?
The canonical SMILES for 2-(phenylmethoxymethyl)-1,3-dithiolane is c1ccc(COCC2SCCS2)cc1.
What is the InChIKey of 2-(phenylmethoxymethyl)-1,3-dithiolane?
The InChIKey is PNLLMBZPRSWHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS2/c1-2-4-10(5-3-1)8-12-9-11-13-6-7-14-11/h1-5,11H,6-9H2.
What are the key properties of 2-(phenylmethoxymethyl)-1,3-dithiolane?
2-(phenylmethoxymethyl)-1,3-dithiolane has a molecular weight of 226.37 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenylmethoxymethyl)-1,3-dithiolane is sourced from PubChem (CID 10242821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).