C24H21N — CID 102428892
3-[(E,1R)-1,3-diphenylprop-2-enyl]-6-methyl-1H-indole (PubChem CID 102428892) has the molecular formula C24H21N and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[(E,1R)-1,3-diphenylprop-2-enyl]-6-methyl-1H-indole.
| Compound Name | 3-[(E,1R)-1,3-diphenylprop-2-enyl]-6-methyl-1H-indole |
|---|---|
| PubChem CID | 102428892 |
| Molecular Formula | C24H21N |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-[(E,1R)-1,3-diphenylprop-2-enyl]-6-methyl-1H-indole |
| SMILES | Cc1ccc2c([C@H](/C=C/c3ccccc3)c3ccccc3)c[nH]c2c1 |
| InChI | InChI=1S/C24H21N/c1-18-12-14-22-23(17-25-24(22)16-18)21(20-10-6-3-7-11-20)15-13-19-8-4-2-5-9-19/h2-17,21,25H,1H3/b15-13+/t21-/m1/s1 |
| InChIKey | QSGJIWAKOKHIOW-UACNQURRSA-N |
| XLogP | 6.32 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |