About 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one
3-cyclopropylpyrido[3,4-d]pyrimidin-4-one (PubChem CID 102429049) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one |
| PubChem CID | 102429049 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1c2ccncc2ncn1C1CC1 |
| InChI | InChI=1S/C10H9N3O/c14-10-8-3-4-11-5-9(8)12-6-13(10)7-1-2-7/h3-7H,1-2H2 |
| InChIKey | AOXHEOOBKYLKPQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one?
The IUPAC name of 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one (CID 102429049) is 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one?
The canonical SMILES for 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one is O=c1c2ccncc2ncn1C1CC1.
What is the InChIKey of 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one?
The InChIKey is AOXHEOOBKYLKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c14-10-8-3-4-11-5-9(8)12-6-13(10)7-1-2-7/h3-7H,1-2H2.
What are the key properties of 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one?
3-cyclopropylpyrido[3,4-d]pyrimidin-4-one has a molecular weight of 187.20 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylpyrido[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 102429049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).