C51H72O18 — CID 102429485
7-O-[[3,5-bis[6-[(5-methyl-1,3-dioxan-5-yl)methoxycarbonyl]hept-6-enoyloxymethyl]phenyl]methyl] 1-O-[(5-methyl-1,3-dioxan-5-yl)methyl] 2-methylideneheptanedioate (PubChem CID 102429485) has the molecular formula C51H72O18 and a molecular weight of 973.12 g/mol. Its IUPAC name is 7-O-[[3,5-bis[6-[(5-methyl-1,3-dioxan-5-yl)methoxycarbonyl]hept-6-enoyloxymethyl]phenyl]methyl] 1-O-[(5-methyl-1,3-dioxan-5-yl)methyl] 2-methylideneheptanedioate.
| Compound Name | 7-O-[[3,5-bis[6-[(5-methyl-1,3-dioxan-5-yl)methoxycarbonyl]hept-6-enoyloxymethyl]phenyl]methyl] 1-O-[(5-methyl-1,3-dioxan-5-yl)methyl] 2-methylideneheptanedioate |
|---|---|
| PubChem CID | 102429485 |
| Molecular Formula | C51H72O18 |
| Molecular Weight | 973.12 g/mol |
| Exact Mass | 972.47 |
| IUPAC Name | 7-O-[[3,5-bis[6-[(5-methyl-1,3-dioxan-5-yl)methoxycarbonyl]hept-6-enoyloxymethyl]phenyl]methyl] 1-O-[(5-methyl-1,3-dioxan-5-yl)methyl] 2-methylideneheptanedioate |
| SMILES | C=C(CCCCC(=O)OCc1cc(COC(=O)CCCCC(=C)C(=O)OCC2(C)COCOC2)cc(COC(=O)CCCCC(=C)C(=O)OCC2(C)COCOC2)c1)C(=O)OCC1(C)COCOC1 |
| InChI | InChI=1S/C51H72O18/c1-37(46(55)67-31-49(4)25-58-34-59-26-49)13-7-10-16-43(52)64-22-40-19-41(23-65-44(53)17-11-8-14-38(2)47(56)68-32-50(5)27-60-35-61-28-50)21-42(20-40)24-66-45(54)18-12-9-15-39(3)48(57)69-33-51(6)29-62-36-63-30-51/h19-21H,1-3,7-18,22-36H2,4-6H3 |
| InChIKey | JSUFNFSCTUYIAD-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.12 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|