C24H34O6 — CID 102429690
[(5R,7R,8S)-7-acetyloxy-3,4-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]methyl acetate (PubChem CID 102429690) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(5R,7R,8S)-7-acetyloxy-3,4-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]methyl acetate.
| Compound Name | [(5R,7R,8S)-7-acetyloxy-3,4-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102429690 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(5R,7R,8S)-7-acetyloxy-3,4-dihydroxy-5-methyl-8-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]methyl acetate |
| SMILES | CC(=O)OCc1cc2c(c(O)c1O)[C@H](C)C[C@@H](OC(C)=O)[C@H]2[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C24H34O6/c1-13(2)8-7-9-14(3)21-19-11-18(12-29-16(5)25)23(27)24(28)22(19)15(4)10-20(21)30-17(6)26/h8,11,14-15,20-21,27-28H,7,9-10,12H2,1-6H3/t14-,15+,20+,21-/m0/s1 |
| InChIKey | HCXFGBUNINQDLC-RSMHBEIYSA-N |
| XLogP | 5.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|