C27H32O6 — CID 102430306
(1S,2S,11R,19S)-6,11,14,19-tetramethyl-4-(3-methylbut-2-enyl)-10,12,20-trioxapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-3(8),4,6,13(21),14,16-hexaene-5,7,15-triol (PubChem CID 102430306) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (1S,2S,11R,19S)-6,11,14,19-tetramethyl-4-(3-methylbut-2-enyl)-10,12,20-trioxapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-3(8),4,6,13(21),14,16-hexaene-5,7,15-triol.
| Compound Name | (1S,2S,11R,19S)-6,11,14,19-tetramethyl-4-(3-methylbut-2-enyl)-10,12,20-trioxapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-3(8),4,6,13(21),14,16-hexaene-5,7,15-triol |
|---|---|
| PubChem CID | 102430306 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (1S,2S,11R,19S)-6,11,14,19-tetramethyl-4-(3-methylbut-2-enyl)-10,12,20-trioxapentacyclo[11.7.1.02,11.03,8.017,21]henicosa-3(8),4,6,13(21),14,16-hexaene-5,7,15-triol |
| SMILES | CC(C)=CCc1c(O)c(C)c(O)c2c1[C@H]1[C@@H]3O[C@@H](C)Cc4cc(O)c(C)c(c43)O[C@@]1(C)OC2 |
| InChI | InChI=1S/C27H32O6/c1-12(2)7-8-17-21-18(24(30)15(5)23(17)29)11-31-27(6)22(21)26-20-16(9-13(3)32-26)10-19(28)14(4)25(20)33-27/h7,10,13,22,26,28-30H,8-9,11H2,1-6H3/t13-,22-,26+,27+/m0/s1 |
| InChIKey | LPXNXIXQBYOZFL-VKYYYYTMSA-N |
| XLogP | 5.35 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|