About 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline
4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline (PubChem CID 102430684) has the molecular formula C34H24FN3
and a molecular weight of 493.59 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline |
| PubChem CID | 102430684 |
| Molecular Formula | C34H24FN3 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline |
| SMILES | Fc1ccc(-c2ccc(N(c3ccc(-c4ccncc4)cc3)c3ccc(-c4ccncc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H24FN3/c35-31-9-1-25(2-10-31)26-3-11-32(12-4-26)38(33-13-5-27(6-14-33)29-17-21-36-22-18-29)34-15-7-28(8-16-34)30-19-23-37-24-20-30/h1-24H |
| InChIKey | VREWCKWZTVSHJQ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline?
The IUPAC name of 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline (CID 102430684) is 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline.
What is the SMILES notation for 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline?
The canonical SMILES for 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline is Fc1ccc(-c2ccc(N(c3ccc(-c4ccncc4)cc3)c3ccc(-c4ccncc4)cc3)cc2)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline?
The InChIKey is VREWCKWZTVSHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H24FN3/c35-31-9-1-25(2-10-31)26-3-11-32(12-4-26)38(33-13-5-27(6-14-33)29-17-21-36-22-18-29)34-15-7-28(8-16-34)30-19-23-37-24-20-30/h1-24H.
What are the key properties of 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline?
4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline has a molecular weight of 493.59 g/mol, XLogP of 9.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-N,N-bis(4-pyridin-4-ylphenyl)aniline is sourced from PubChem (CID 102430684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).