C38H30N6O2 — CID 102430871
(1R)-21-methyl-1-[(E)-2-[2-(1-methyl-4-oxoquinazolin-2-yl)-1H-indol-3-yl]ethenyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one (PubChem CID 102430871) has the molecular formula C38H30N6O2 and a molecular weight of 602.70 g/mol. Its IUPAC name is (1R)-21-methyl-1-[(E)-2-[2-(1-methyl-4-oxoquinazolin-2-yl)-1H-indol-3-yl]ethenyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one.
| Compound Name | (1R)-21-methyl-1-[(E)-2-[2-(1-methyl-4-oxoquinazolin-2-yl)-1H-indol-3-yl]ethenyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
|---|---|
| PubChem CID | 102430871 |
| Molecular Formula | C38H30N6O2 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | (1R)-21-methyl-1-[(E)-2-[2-(1-methyl-4-oxoquinazolin-2-yl)-1H-indol-3-yl]ethenyl]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,15,17,19-heptaen-14-one |
| SMILES | CN1c2ccccc2C(=O)N2CCc3c([nH]c4ccccc34)[C@@]21/C=C/c1c(-c2nc(=O)c3ccccc3n2C)[nH]c2ccccc12 |
| InChI | InChI=1S/C38H30N6O2/c1-42-31-17-9-5-13-27(31)36(45)41-35(42)33-25(23-11-3-7-15-29(23)39-33)19-21-38-34-26(24-12-4-8-16-30(24)40-34)20-22-44(38)37(46)28-14-6-10-18-32(28)43(38)2/h3-19,21,39-40H,20,22H2,1-2H3/b21-19+/t38-/m1/s1 |
| InChIKey | NAOZUJGYGKPDRI-BCSLPRMTSA-N |
| XLogP | 6.58 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|