C16H13NO4 — CID 102431032
5-methoxy-14,16-dioxa-10-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaen-9-one (PubChem CID 102431032) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 5-methoxy-14,16-dioxa-10-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaen-9-one.
| Compound Name | 5-methoxy-14,16-dioxa-10-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaen-9-one |
|---|---|
| PubChem CID | 102431032 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-methoxy-14,16-dioxa-10-azatetracyclo[9.7.0.03,8.013,17]octadeca-1(18),3(8),4,6,11,13(17)-hexaen-9-one |
| SMILES | COc1ccc2c(c1)Cc1cc3c(cc1NC2=O)OCO3 |
| InChI | InChI=1S/C16H13NO4/c1-19-11-2-3-12-9(5-11)4-10-6-14-15(21-8-20-14)7-13(10)17-16(12)18/h2-3,5-7H,4,8H2,1H3,(H,17,18) |
| InChIKey | GPGPXRDEMZCTSH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |