C15H20FNO2S — CID 102431134
(2R)-2-[(E,3R)-3-fluorobut-1-enyl]-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 102431134) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-2-[(E,3R)-3-fluorobut-1-enyl]-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | (2R)-2-[(E,3R)-3-fluorobut-1-enyl]-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 102431134 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2R)-2-[(E,3R)-3-fluorobut-1-enyl]-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2/C=C/[C@@H](C)F)cc1 |
| InChI | InChI=1S/C15H20FNO2S/c1-12-5-9-15(10-6-12)20(18,19)17-11-3-4-14(17)8-7-13(2)16/h5-10,13-14H,3-4,11H2,1-2H3/b8-7+/t13-,14-/m1/s1 |
| InChIKey | UBYADWKKDNKCCP-GODNBWANSA-N |
| XLogP | 3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|