C27H34O3 — CID 102431261
5-[4-[(E)-2-(4-butylphenyl)ethenyl]phenoxy]pentyl 2-methylprop-2-enoate (PubChem CID 102431261) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is 5-[4-[(E)-2-(4-butylphenyl)ethenyl]phenoxy]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[4-[(E)-2-(4-butylphenyl)ethenyl]phenoxy]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102431261 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 5-[4-[(E)-2-(4-butylphenyl)ethenyl]phenoxy]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc(/C=C/c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C27H34O3/c1-4-5-9-23-10-12-24(13-11-23)14-15-25-16-18-26(19-17-25)29-20-7-6-8-21-30-27(28)22(2)3/h10-19H,2,4-9,20-21H2,1,3H3/b15-14+ |
| InChIKey | LXKCGNCBVJFSQW-CCEZHUSRSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|