About [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone
[7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone (PubChem CID 102431265) has the molecular formula C39H40F2O2
and a molecular weight of 578.74 g/mol. Its IUPAC name is [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone |
| PubChem CID | 102431265 |
| Molecular Formula | C39H40F2O2 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(=O)c3ccc(F)cc3)ccc2-c2ccc(C(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C39H40F2O2/c1-3-5-7-9-23-39(24-10-8-6-4-2)35-25-29(37(42)27-11-17-31(40)18-12-27)15-21-33(35)34-22-16-30(26-36(34)39)38(43)28-13-19-32(41)20-14-28/h11-22,25-26H,3-10,23-24H2,1-2H3 |
| InChIKey | GUKMHBHQZLPYBS-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone?
The IUPAC name of [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone (CID 102431265) is [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone?
The canonical SMILES for [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone is CCCCCCC1(CCCCCC)c2cc(C(=O)c3ccc(F)cc3)ccc2-c2ccc(C(=O)c3ccc(F)cc3)cc21.
What is the InChIKey of [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone?
The InChIKey is GUKMHBHQZLPYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H40F2O2/c1-3-5-7-9-23-39(24-10-8-6-4-2)35-25-29(37(42)27-11-17-31(40)18-12-27)15-21-33(35)34-22-16-30(26-36(34)39)38(43)28-13-19-32(41)20-14-28/h11-22,25-26H,3-10,23-24H2,1-2H3.
What are the key properties of [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone?
[7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone has a molecular weight of 578.74 g/mol, XLogP of 10.63, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(4-fluorobenzoyl)-9,9-dihexylfluoren-2-yl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 102431265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).