C15H22O2 — CID 10243134
(4S,5S,8S,8aS)-2,2,8-trimethyl-4,5,6,7,8,8a-hexahydro-1H-azulene-4,5-dicarbaldehyde (PubChem CID 10243134) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4S,5S,8S,8aS)-2,2,8-trimethyl-4,5,6,7,8,8a-hexahydro-1H-azulene-4,5-dicarbaldehyde.
| Compound Name | (4S,5S,8S,8aS)-2,2,8-trimethyl-4,5,6,7,8,8a-hexahydro-1H-azulene-4,5-dicarbaldehyde |
|---|---|
| PubChem CID | 10243134 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4S,5S,8S,8aS)-2,2,8-trimethyl-4,5,6,7,8,8a-hexahydro-1H-azulene-4,5-dicarbaldehyde |
| SMILES | C[C@H]1CC[C@H](C=O)[C@H](C=O)C2=CC(C)(C)C[C@H]21 |
| InChI | InChI=1S/C15H22O2/c1-10-4-5-11(8-16)14(9-17)13-7-15(2,3)6-12(10)13/h7-12,14H,4-6H2,1-3H3/t10-,11+,12-,14-/m0/s1 |
| InChIKey | PIDWXMMRRLYHKF-OPDFLTKYSA-N |
| XLogP | 3.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|