About 2-cyclohexylidene-1,3-benzodithiole
2-cyclohexylidene-1,3-benzodithiole (PubChem CID 10243140) has the molecular formula C13H14S2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-cyclohexylidene-1,3-benzodithiole.
Molecular Properties
| Compound Name | 2-cyclohexylidene-1,3-benzodithiole |
| PubChem CID | 10243140 |
| Molecular Formula | C13H14S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-cyclohexylidene-1,3-benzodithiole |
| SMILES | c1ccc2c(c1)SC(=C1CCCCC1)S2 |
| InChI | InChI=1S/C13H14S2/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h4-5,8-9H,1-3,6-7H2 |
| InChIKey | CPJIYMFUGSWLHE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexylidene-1,3-benzodithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylidene-1,3-benzodithiole?
The IUPAC name of 2-cyclohexylidene-1,3-benzodithiole (CID 10243140) is 2-cyclohexylidene-1,3-benzodithiole.
What is the SMILES notation for 2-cyclohexylidene-1,3-benzodithiole?
The canonical SMILES for 2-cyclohexylidene-1,3-benzodithiole is c1ccc2c(c1)SC(=C1CCCCC1)S2.
What is the InChIKey of 2-cyclohexylidene-1,3-benzodithiole?
The InChIKey is CPJIYMFUGSWLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14S2/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h4-5,8-9H,1-3,6-7H2.
What are the key properties of 2-cyclohexylidene-1,3-benzodithiole?
2-cyclohexylidene-1,3-benzodithiole has a molecular weight of 234.39 g/mol, XLogP of 5.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylidene-1,3-benzodithiole is sourced from PubChem (CID 10243140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).