About 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole
2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole (PubChem CID 102431662) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole |
| PubChem CID | 102431662 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole |
| SMILES | CC1(C)CN=C(c2ccc3c(c2)OC=CC3)O1 |
| InChI | InChI=1S/C14H15NO2/c1-14(2)9-15-13(17-14)11-6-5-10-4-3-7-16-12(10)8-11/h3,5-8H,4,9H2,1-2H3 |
| InChIKey | KLUWOUMFRKNSFN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole?
The IUPAC name of 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole (CID 102431662) is 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole.
What is the SMILES notation for 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole?
The canonical SMILES for 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole is CC1(C)CN=C(c2ccc3c(c2)OC=CC3)O1.
What is the InChIKey of 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole?
The InChIKey is KLUWOUMFRKNSFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-14(2)9-15-13(17-14)11-6-5-10-4-3-7-16-12(10)8-11/h3,5-8H,4,9H2,1-2H3.
What are the key properties of 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole?
2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole has a molecular weight of 229.28 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4H-chromen-7-yl)-5,5-dimethyl-4H-1,3-oxazole is sourced from PubChem (CID 102431662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).