C13H19N3O5SSi — CID 102431891
(6S)-2,2,4,6-tetramethyl-1-(4-nitrophenyl)sulfonyl-1,4,2-diazasilinan-5-one (PubChem CID 102431891) has the molecular formula C13H19N3O5SSi and a molecular weight of 357.46 g/mol. Its IUPAC name is (6S)-2,2,4,6-tetramethyl-1-(4-nitrophenyl)sulfonyl-1,4,2-diazasilinan-5-one.
| Compound Name | (6S)-2,2,4,6-tetramethyl-1-(4-nitrophenyl)sulfonyl-1,4,2-diazasilinan-5-one |
|---|---|
| PubChem CID | 102431891 |
| Molecular Formula | C13H19N3O5SSi |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (6S)-2,2,4,6-tetramethyl-1-(4-nitrophenyl)sulfonyl-1,4,2-diazasilinan-5-one |
| SMILES | C[C@H]1C(=O)N(C)C[Si](C)(C)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H19N3O5SSi/c1-10-13(17)14(2)9-23(3,4)16(10)22(20,21)12-7-5-11(6-8-12)15(18)19/h5-8,10H,9H2,1-4H3/t10-/m0/s1 |
| InChIKey | CHHKOPXKEMMDFQ-JTQLQIEISA-N |
| XLogP | 1.19 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|