C23H21N3 — CID 102432217
2-methyl-N,5,6-triphenyl-4,5-dihydropyridazin-3-imine (PubChem CID 102432217) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-methyl-N,5,6-triphenyl-4,5-dihydropyridazin-3-imine.
| Compound Name | 2-methyl-N,5,6-triphenyl-4,5-dihydropyridazin-3-imine |
|---|---|
| PubChem CID | 102432217 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-methyl-N,5,6-triphenyl-4,5-dihydropyridazin-3-imine |
| SMILES | CN1N=C(c2ccccc2)C(c2ccccc2)C/C1=N\c1ccccc1 |
| InChI | InChI=1S/C23H21N3/c1-26-22(24-20-15-9-4-10-16-20)17-21(18-11-5-2-6-12-18)23(25-26)19-13-7-3-8-14-19/h2-16,21H,17H2,1H3/b24-22+ |
| InChIKey | HXUWBDDOQSGYCA-ZNTNEXAZSA-N |
| XLogP | 5.24 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|