C17H27BrO4 — CID 102432670
(1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one (PubChem CID 102432670) has the molecular formula C17H27BrO4 and a molecular weight of 375.30 g/mol. Its IUPAC name is (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one.
| Compound Name | (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one |
|---|---|
| PubChem CID | 102432670 |
| Molecular Formula | C17H27BrO4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (1S,3S,8R,11R)-14-bromo-1,8,13,13-tetramethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one |
| SMILES | CC1(C)O[C@@H]2CC[C@@]3(C)OC(=O)CC[C@@H]3O[C@@]2(C)CCC1Br |
| InChI | InChI=1S/C17H27BrO4/c1-15(2)11(18)7-9-16(3)13(20-15)8-10-17(4)12(21-16)5-6-14(19)22-17/h11-13H,5-10H2,1-4H3/t11?,12-,13+,16-,17+/m0/s1 |
| InChIKey | VNOJQVLFJGUNII-WNOJMDLFSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|