C34H33N3O5 — CID 102433391
4,5-dihydroxy-9,10-dioxo-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]anthracene-2-carboxamide (PubChem CID 102433391) has the molecular formula C34H33N3O5 and a molecular weight of 563.65 g/mol. Its IUPAC name is 4,5-dihydroxy-9,10-dioxo-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]anthracene-2-carboxamide.
| Compound Name | 4,5-dihydroxy-9,10-dioxo-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]anthracene-2-carboxamide |
|---|---|
| PubChem CID | 102433391 |
| Molecular Formula | C34H33N3O5 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 4,5-dihydroxy-9,10-dioxo-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]anthracene-2-carboxamide |
| SMILES | O=C(NCCCCCCNc1c2c(nc3ccccc13)CCCC2)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C34H33N3O5/c38-27-15-9-12-23-29(27)33(41)30-24(32(23)40)18-20(19-28(30)39)34(42)36-17-8-2-1-7-16-35-31-21-10-3-5-13-25(21)37-26-14-6-4-11-22(26)31/h3,5,9-10,12-13,15,18-19,38-39H,1-2,4,6-8,11,14,16-17H2,(H,35,37)(H,36,42) |
| InChIKey | RGDHUSBWRVJIDQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|