About (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione
(2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione (PubChem CID 102433401) has the molecular formula C19H14FNO3
and a molecular weight of 323.32 g/mol. Its IUPAC name is (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione.
Molecular Properties
| Compound Name | (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione |
| PubChem CID | 102433401 |
| Molecular Formula | C19H14FNO3 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione |
| SMILES | O=C1C=CO[C@]2(C1)C(=O)N(Cc1ccccc1)c1ccc(F)cc12 |
| InChI | InChI=1S/C19H14FNO3/c20-14-6-7-17-16(10-14)19(11-15(22)8-9-24-19)18(23)21(17)12-13-4-2-1-3-5-13/h1-10H,11-12H2/t19-/m0/s1 |
| InChIKey | HSKRTWCXNFFGAX-IBGZPJMESA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione?
The IUPAC name of (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione (CID 102433401) is (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione.
What is the SMILES notation for (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione?
The canonical SMILES for (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione is O=C1C=CO[C@]2(C1)C(=O)N(Cc1ccccc1)c1ccc(F)cc12.
What is the InChIKey of (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione?
The InChIKey is HSKRTWCXNFFGAX-IBGZPJMESA-N. The full InChI is InChI=1S/C19H14FNO3/c20-14-6-7-17-16(10-14)19(11-15(22)8-9-24-19)18(23)21(17)12-13-4-2-1-3-5-13/h1-10H,11-12H2/t19-/m0/s1.
What are the key properties of (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione?
(2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione has a molecular weight of 323.32 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1'-benzyl-5'-fluorospiro[3H-pyran-2,3'-indole]-2',4-dione is sourced from PubChem (CID 102433401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).