About 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene
1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene (PubChem CID 102433732) has the molecular formula C30H26F6N2O4
and a molecular weight of 592.54 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene.
Molecular Properties
| Compound Name | 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene |
| PubChem CID | 102433732 |
| Molecular Formula | C30H26F6N2O4 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene |
| SMILES | CC(C)(C)c1cc(Oc2ccc(N=C=O)cc2C(F)(F)F)c(C(C)(C)C)cc1Oc1ccc(N=C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C30H26F6N2O4/c1-27(2,3)19-13-26(42-24-10-8-18(38-16-40)12-22(24)30(34,35)36)20(28(4,5)6)14-25(19)41-23-9-7-17(37-15-39)11-21(23)29(31,32)33/h7-14H,1-6H3 |
| InChIKey | PYJHRRARLDNELV-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene?
The IUPAC name of 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene (CID 102433732) is 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene.
What is the SMILES notation for 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene?
The canonical SMILES for 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene is CC(C)(C)c1cc(Oc2ccc(N=C=O)cc2C(F)(F)F)c(C(C)(C)C)cc1Oc1ccc(N=C=O)cc1C(F)(F)F.
What is the InChIKey of 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene?
The InChIKey is PYJHRRARLDNELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26F6N2O4/c1-27(2,3)19-13-26(42-24-10-8-18(38-16-40)12-22(24)30(34,35)36)20(28(4,5)6)14-25(19)41-23-9-7-17(37-15-39)11-21(23)29(31,32)33/h7-14H,1-6H3.
What are the key properties of 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene?
1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene has a molecular weight of 592.54 g/mol, XLogP of 9.84, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butyl-2,5-bis[4-isocyanato-2-(trifluoromethyl)phenoxy]benzene is sourced from PubChem (CID 102433732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).