C16H20N2 — CID 10243377
3,5-dimethyl-8-piperidin-3-ylquinoline (PubChem CID 10243377) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3,5-dimethyl-8-piperidin-3-ylquinoline.
| Compound Name | 3,5-dimethyl-8-piperidin-3-ylquinoline |
|---|---|
| PubChem CID | 10243377 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3,5-dimethyl-8-piperidin-3-ylquinoline |
| SMILES | Cc1cnc2c(C3CCCNC3)ccc(C)c2c1 |
| InChI | InChI=1S/C16H20N2/c1-11-8-15-12(2)5-6-14(16(15)18-9-11)13-4-3-7-17-10-13/h5-6,8-9,13,17H,3-4,7,10H2,1-2H3 |
| InChIKey | LKRKRCLIBRBZBT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |