C32H40O5Si — CID 102433783
ethyl (E,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-4-methyl-5-phenylpent-2-enoate (PubChem CID 102433783) has the molecular formula C32H40O5Si and a molecular weight of 532.75 g/mol. Its IUPAC name is ethyl (E,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-4-methyl-5-phenylpent-2-enoate.
| Compound Name | ethyl (E,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-4-methyl-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 102433783 |
| Molecular Formula | C32H40O5Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | ethyl (E,4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(methoxymethoxy)-4-methyl-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(/O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)[C@@H](OCOC)c1ccccc1 |
| InChI | InChI=1S/C32H40O5Si/c1-7-35-30(33)23-29(25(2)31(36-24-34-6)26-17-11-8-12-18-26)37-38(32(3,4)5,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-23,25,31H,7,24H2,1-6H3/b29-23+/t25-,31+/m0/s1 |
| InChIKey | GJUKPRFRKIOSKS-FQBNYPIPSA-N |
| XLogP | 6.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|