C26H38O3 — CID 102433924
(3R)-3-[(E)-5-[2,4-bis(2-methylbut-3-en-2-yloxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane (PubChem CID 102433924) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (3R)-3-[(E)-5-[2,4-bis(2-methylbut-3-en-2-yloxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane.
| Compound Name | (3R)-3-[(E)-5-[2,4-bis(2-methylbut-3-en-2-yloxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 102433924 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (3R)-3-[(E)-5-[2,4-bis(2-methylbut-3-en-2-yloxy)phenyl]-3-methylpent-3-enyl]-2,2-dimethyloxirane |
| SMILES | C=CC(C)(C)Oc1ccc(C/C=C(\C)CC[C@H]2OC2(C)C)c(OC(C)(C)C=C)c1 |
| InChI | InChI=1S/C26H38O3/c1-10-24(4,5)27-21-16-15-20(22(18-21)28-25(6,7)11-2)14-12-19(3)13-17-23-26(8,9)29-23/h10-12,15-16,18,23H,1-2,13-14,17H2,3-9H3/b19-12+/t23-/m1/s1 |
| InChIKey | MMWAIULNASWRSV-NOPGXUSGSA-N |
| XLogP | 6.82 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|