C17H34O2Si — CID 102434144
(2E,4S)-4,8-dimethyl-4-triethylsilyloxynona-2,7-dien-1-ol (PubChem CID 102434144) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (2E,4S)-4,8-dimethyl-4-triethylsilyloxynona-2,7-dien-1-ol.
| Compound Name | (2E,4S)-4,8-dimethyl-4-triethylsilyloxynona-2,7-dien-1-ol |
|---|---|
| PubChem CID | 102434144 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2E,4S)-4,8-dimethyl-4-triethylsilyloxynona-2,7-dien-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@](C)(/C=C/CO)CCC=C(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-7-20(8-2,9-3)19-17(6,14-11-15-18)13-10-12-16(4)5/h11-12,14,18H,7-10,13,15H2,1-6H3/b14-11+/t17-/m0/s1 |
| InChIKey | PIVXAIJYUITANP-WKOYGUFESA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|