C12H10N4S — CID 10243449
8-benzyl-1H-imidazo[1,5-a][1,3,5]triazine-4-thione (PubChem CID 10243449) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is 8-benzyl-1H-imidazo[1,5-a][1,3,5]triazine-4-thione.
| Compound Name | 8-benzyl-1H-imidazo[1,5-a][1,3,5]triazine-4-thione |
|---|---|
| PubChem CID | 10243449 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 8-benzyl-1H-imidazo[1,5-a][1,3,5]triazine-4-thione |
| SMILES | S=c1nc[nH]c2c(Cc3ccccc3)ncn12 |
| InChI | InChI=1S/C12H10N4S/c17-12-14-7-13-11-10(15-8-16(11)12)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,13,14,17) |
| InChIKey | HSKPLUCPMNOYES-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|