About (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane
(2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane (PubChem CID 102434550) has the molecular formula C20H24O3
and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane.
Molecular Properties
| Compound Name | (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane |
| PubChem CID | 102434550 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane |
| SMILES | COC(OC)C1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H24O3/c1-21-20(22-2)17-13-18(15-9-5-3-6-10-15)23-19(14-17)16-11-7-4-8-12-16/h3-12,17-20H,13-14H2,1-2H3/t17?,18-,19+ |
| InChIKey | QSGPQVJPIBKOHT-YQQQUEKLSA-N |
| XLogP | 4.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane?
The IUPAC name of (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane (CID 102434550) is (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane.
What is the SMILES notation for (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane?
The canonical SMILES for (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane is COC(OC)C1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)C1.
What is the InChIKey of (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane?
The InChIKey is QSGPQVJPIBKOHT-YQQQUEKLSA-N. The full InChI is InChI=1S/C20H24O3/c1-21-20(22-2)17-13-18(15-9-5-3-6-10-15)23-19(14-17)16-11-7-4-8-12-16/h3-12,17-20H,13-14H2,1-2H3/t17?,18-,19+.
What are the key properties of (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane?
(2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane has a molecular weight of 312.41 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(dimethoxymethyl)-2,6-diphenyloxane is sourced from PubChem (CID 102434550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).