About 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one
3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one (PubChem CID 102434641) has the molecular formula C13H13FO
and a molecular weight of 204.24 g/mol. Its IUPAC name is 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one.
Molecular Properties
| Compound Name | 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one |
| PubChem CID | 102434641 |
| Molecular Formula | C13H13FO |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one |
| SMILES | O=C1CCC12c1ccccc1CCC2F |
| InChI | InChI=1S/C13H13FO/c14-11-6-5-9-3-1-2-4-10(9)13(11)8-7-12(13)15/h1-4,11H,5-8H2 |
| InChIKey | XNYONTYDKAGZTO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one?
The IUPAC name of 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one (CID 102434641) is 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one.
What is the SMILES notation for 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one?
The canonical SMILES for 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one is O=C1CCC12c1ccccc1CCC2F.
What is the InChIKey of 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one?
The InChIKey is XNYONTYDKAGZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO/c14-11-6-5-9-3-1-2-4-10(9)13(11)8-7-12(13)15/h1-4,11H,5-8H2.
What are the key properties of 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one?
3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one has a molecular weight of 204.24 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorospiro[2,3-dihydro-1H-naphthalene-4,2'-cyclobutane]-1'-one is sourced from PubChem (CID 102434641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).