About 6-ethoxytridecan-7-one
6-ethoxytridecan-7-one (PubChem CID 10243469) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 6-ethoxytridecan-7-one.
Molecular Properties
| Compound Name | 6-ethoxytridecan-7-one |
| PubChem CID | 10243469 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 6-ethoxytridecan-7-one |
| SMILES | CCCCCCC(=O)C(CCCCC)OCC |
| InChI | InChI=1S/C15H30O2/c1-4-7-9-11-12-14(16)15(17-6-3)13-10-8-5-2/h15H,4-13H2,1-3H3 |
| InChIKey | UFMQPESEZKBNIL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxytridecan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxytridecan-7-one?
The IUPAC name of 6-ethoxytridecan-7-one (CID 10243469) is 6-ethoxytridecan-7-one.
What is the SMILES notation for 6-ethoxytridecan-7-one?
The canonical SMILES for 6-ethoxytridecan-7-one is CCCCCCC(=O)C(CCCCC)OCC.
What is the InChIKey of 6-ethoxytridecan-7-one?
The InChIKey is UFMQPESEZKBNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-4-7-9-11-12-14(16)15(17-6-3)13-10-8-5-2/h15H,4-13H2,1-3H3.
What are the key properties of 6-ethoxytridecan-7-one?
6-ethoxytridecan-7-one has a molecular weight of 242.40 g/mol, XLogP of 4.51, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxytridecan-7-one is sourced from PubChem (CID 10243469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).