C13H22N2O — CID 102434737
(3R,4aR,8aR)-3-cyclopentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one (PubChem CID 102434737) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (3R,4aR,8aR)-3-cyclopentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one.
| Compound Name | (3R,4aR,8aR)-3-cyclopentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 102434737 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (3R,4aR,8aR)-3-cyclopentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@H]2N[C@@H]1C1CCCC1 |
| InChI | InChI=1S/C13H22N2O/c16-13-12(9-5-1-2-6-9)14-10-7-3-4-8-11(10)15-13/h9-12,14H,1-8H2,(H,15,16)/t10-,11-,12-/m1/s1 |
| InChIKey | GIWZYGNRXDLXJG-IJLUTSLNSA-N |
| XLogP | 1.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |